What is the chemical name for H3P?
H3P : Summary
| Code | H3P |
|---|---|
| Molecule name | 2,2′-methanediylbis(3,4,6-trichlorophenol) |
| Systematic names | Program Version Name ACDLabs 10.04 2,2′-methanediylbis(3,4,6-trichlorophenol) OpenEye OEToolkits 1.5.0 3,4,6-trichloro-2-[(2,3,5-trichloro-6-hydroxy-phenyl)methyl]phenol |
| Formula | C13 H6 Cl6 O2 |
| Formal charge | 0 |
What is the name of P2O5?
tricyclo[3.3.1.13,7]tetraphosphoxane 1,3,5,7-tetraoxide
Phosphorus pentoxide/IUPAC ID
What is the name for the compound with the formula B2Cl4?
Diboron tetrachloride
Diboron tetrachloride
| PubChem CID | 139548 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | B2Cl4 |
| Synonyms | Diboron tetrachloride B2Cl4 13701-67-2 UNII-3KKJ90L3I5 dichloro(dichloroboranyl)borane More… |
| Molecular Weight | 163.4 |
How many single bonds are in N2H4?
(e) N2H4: Each nitrogen atom (Group 5A) will make three bonds, one single bond with the other nitrogen and one each with two hydrogens.
What is the molar mass of H3P?
Identification of Phosphine Chemical Compound
| Chemical Formula | H3P |
|---|---|
| Molecular Weight | 33.99758 g/mol |
| IUPAC Name | phosphane |
| SMILES String | P |
| InChI | InChI=1S/H3P/h1H3 |
What is the name of Cl2O7?
Chlorine heptoxide Dichlorine
Chlorine heptoxide
| PubChem CID | 123272 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | Cl2O7 |
| Synonyms | Chlorine heptoxide Dichlorine heptoxide Perchloric anhydride Chlorine oxide (Cl2O7) 12015-53-1 More… |
| Molecular Weight | 182.90 |
What is the name for the compound with the formula Ba3N2?
Barium nitride (Ba3N2)
What is the correct Iupac name for P4S3?
Tetraphosphorus trisulfide PHOSPHORUS SESQUISULFIDE
| IUPAC Name | |
|---|---|
| Alternative Names | Tetraphosphorus trisulfide PHOSPHORUS SESQUISULFIDE Trisulfurated phosphorus Phosphorous sesquisulfide Tetraphosphorus trisulphide |
| Molecular Formula | P4S3 |
| Molar Mass | 220.075 g/mol |
| InChI | InChI=1S/P4S3/c5-1-2-3(1)7-4(5)6-2 |
How many single bonds are in H3P?
Draw the Lewis Structure for H3P (phosphorus follows the octet rule). How many electron domains are around the central atom? Phosphorus is the central atom with 4 electron domains; three single bonds and one pair of nonbonding electrons.
How do you name N2H4?
The chemical formula for hydrazine is N2H4.
